C29H27ClN2O2S — CID 135605663
(3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-imino-7,7-dimethyl-1-(3-methylphenyl)-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135605663) has the molecular formula C29H27ClN2O2S and a molecular weight of 503.07 g/mol. Its IUPAC name is (3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-imino-7,7-dimethyl-1-(3-methylphenyl)-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-imino-7,7-dimethyl-1-(3-methylphenyl)-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135605663 |
| Molecular Formula | C29H27ClN2O2S |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | (3E)-3-[(4-chlorophenyl)-hydroxymethylidene]-2-imino-7,7-dimethyl-1-(3-methylphenyl)-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(Cl)cc2)/C(c2cccs2)C2=C(CC(C)(C)CC2=O)N/1c1cccc(C)c1 |
| InChI | InChI=1S/C29H27ClN2O2S/c1-17-6-4-7-20(14-17)32-21-15-29(2,3)16-22(33)24(21)25(23-8-5-13-35-23)26(28(32)31)27(34)18-9-11-19(30)12-10-18/h4-14,25,31,34H,15-16H2,1-3H3/b27-26+,31-28- |
| InChIKey | GKFVFUGZEXARFP-MJURHYRISA-N |
| XLogP | 7.90 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|