C30H25Cl2FN2O2 — CID 135605669
(3E)-1-(4-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4-(2-fluorophenyl)-2-imino-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135605669) has the molecular formula C30H25Cl2FN2O2 and a molecular weight of 535.45 g/mol. Its IUPAC name is (3E)-1-(4-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4-(2-fluorophenyl)-2-imino-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E)-1-(4-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4-(2-fluorophenyl)-2-imino-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135605669 |
| Molecular Formula | C30H25Cl2FN2O2 |
| Molecular Weight | 535.45 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | (3E)-1-(4-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4-(2-fluorophenyl)-2-imino-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(Cl)cc2)/C(c2ccccc2F)C2=C(CC(C)(C)CC2=O)N/1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H25Cl2FN2O2/c1-30(2)15-23-26(24(36)16-30)25(21-5-3-4-6-22(21)33)27(28(37)17-7-9-18(31)10-8-17)29(34)35(23)20-13-11-19(32)12-14-20/h3-14,25,34,37H,15-16H2,1-2H3/b28-27+,34-29- |
| InChIKey | PYTYFMUHROEPGB-CRFWYGMYSA-N |
| XLogP | 8.33 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.45 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|