C31H29ClN2O2 — CID 135593131
(3E)-1-(4-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-phenyl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135593131) has the molecular formula C31H29ClN2O2 and a molecular weight of 497.04 g/mol. Its IUPAC name is (3E)-1-(4-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-phenyl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E)-1-(4-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-phenyl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135593131 |
| Molecular Formula | C31H29ClN2O2 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | (3E)-1-(4-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-phenyl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2ccccc2)C2=C(CC(C)(C)CC2=O)N/1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H29ClN2O2/c1-19-9-11-21(12-10-19)29(36)28-26(20-7-5-4-6-8-20)27-24(17-31(2,3)18-25(27)35)34(30(28)33)23-15-13-22(32)14-16-23/h4-16,26,33,36H,17-18H2,1-3H3/b29-28+,33-30- |
| InChIKey | WYDGHCSXFPTOEX-ITZMRVJLSA-N |
| XLogP | 7.84 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|