C31H28ClN3O4 — CID 135569190
(3E)-1-(4-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-(3-nitrophenyl)-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135569190) has the molecular formula C31H28ClN3O4 and a molecular weight of 542.04 g/mol. Its IUPAC name is (3E)-1-(4-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-(3-nitrophenyl)-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E)-1-(4-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-(3-nitrophenyl)-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135569190 |
| Molecular Formula | C31H28ClN3O4 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (3E)-1-(4-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-(3-nitrophenyl)-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2cccc([N+](=O)[O-])c2)C2=C(CC(C)(C)CC2=O)N/1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H28ClN3O4/c1-18-7-9-19(10-8-18)29(37)28-26(20-5-4-6-23(15-20)35(38)39)27-24(16-31(2,3)17-25(27)36)34(30(28)33)22-13-11-21(32)12-14-22/h4-15,26,33,37H,16-17H2,1-3H3/b29-28+,33-30- |
| InChIKey | FTCZAKQJDDXGIR-ITZMRVJLSA-N |
| XLogP | 7.75 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|