C32H31FN2O2 — CID 135593119
(3E)-4-(2-fluorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-1-(2-methylphenyl)-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135593119) has the molecular formula C32H31FN2O2 and a molecular weight of 494.61 g/mol. Its IUPAC name is (3E)-4-(2-fluorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-1-(2-methylphenyl)-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E)-4-(2-fluorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-1-(2-methylphenyl)-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135593119 |
| Molecular Formula | C32H31FN2O2 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (3E)-4-(2-fluorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-1-(2-methylphenyl)-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2ccccc2F)C2=C(CC(C)(C)CC2=O)N/1c1ccccc1C |
| InChI | InChI=1S/C32H31FN2O2/c1-19-13-15-21(16-14-19)30(37)29-27(22-10-6-7-11-23(22)33)28-25(17-32(3,4)18-26(28)36)35(31(29)34)24-12-8-5-9-20(24)2/h5-16,27,34,37H,17-18H2,1-4H3/b30-29+,34-31- |
| InChIKey | CSPXLTUUUINNAQ-NLVGGGPJSA-N |
| XLogP | 7.64 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|