C30H26ClFN2O2 — CID 135734452
(3E)-1-(3-chloro-2-methylphenyl)-4-(2-fluorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135734452) has the molecular formula C30H26ClFN2O2 and a molecular weight of 501.00 g/mol. Its IUPAC name is (3E)-1-(3-chloro-2-methylphenyl)-4-(2-fluorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-1-(3-chloro-2-methylphenyl)-4-(2-fluorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135734452 |
| Molecular Formula | C30H26ClFN2O2 |
| Molecular Weight | 501.00 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (3E)-1-(3-chloro-2-methylphenyl)-4-(2-fluorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2ccccc2F)C2=C(CCCC2=O)N/1c1cccc(Cl)c1C |
| InChI | InChI=1S/C30H26ClFN2O2/c1-17-13-15-19(16-14-17)29(36)28-26(20-7-3-4-9-22(20)32)27-24(11-6-12-25(27)35)34(30(28)33)23-10-5-8-21(31)18(23)2/h3-5,7-10,13-16,26,33,36H,6,11-12H2,1-2H3/b29-28+,33-30- |
| InChIKey | JXRNXGWDVIHZBS-ITZMRVJLSA-N |
| XLogP | 7.65 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.00 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|