C29H26ClN3O2 — CID 135598324
(3E)-1-(3-chloro-2-methylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-pyridin-3-yl-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135598324) has the molecular formula C29H26ClN3O2 and a molecular weight of 484.00 g/mol. Its IUPAC name is (3E)-1-(3-chloro-2-methylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-pyridin-3-yl-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-1-(3-chloro-2-methylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-pyridin-3-yl-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135598324 |
| Molecular Formula | C29H26ClN3O2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | (3E)-1-(3-chloro-2-methylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-pyridin-3-yl-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2cccnc2)C2=C(CCCC2=O)N/1c1cccc(Cl)c1C |
| InChI | InChI=1S/C29H26ClN3O2/c1-17-11-13-19(14-12-17)28(35)27-25(20-6-5-15-32-16-20)26-23(9-4-10-24(26)34)33(29(27)31)22-8-3-7-21(30)18(22)2/h3,5-8,11-16,25,31,35H,4,9-10H2,1-2H3/b28-27+,31-29- |
| InChIKey | AOZVNZLCHUGADA-OGVAXNNSSA-N |
| XLogP | 6.91 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|