C27H22Cl2N2O2S — CID 135707452
(3E)-1-(3,4-dichlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135707452) has the molecular formula C27H22Cl2N2O2S and a molecular weight of 509.46 g/mol. Its IUPAC name is (3E)-1-(3,4-dichlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-1-(3,4-dichlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135707452 |
| Molecular Formula | C27H22Cl2N2O2S |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | (3E)-1-(3,4-dichlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2cccs2)C2=C(CCCC2=O)N/1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H22Cl2N2O2S/c1-15-7-9-16(10-8-15)26(33)25-24(22-6-3-13-34-22)23-20(4-2-5-21(23)32)31(27(25)30)17-11-12-18(28)19(29)14-17/h3,6-14,24,30,33H,2,4-5H2,1H3/b26-25+,30-27- |
| InChIKey | KRQBVMHCQDMNOP-PBEWFDSHSA-N |
| XLogP | 7.92 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|