C28H26N2O2S — CID 135787131
(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1-(4-methylphenyl)-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135787131) has the molecular formula C28H26N2O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is (3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1-(4-methylphenyl)-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1-(4-methylphenyl)-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135787131 |
| Molecular Formula | C28H26N2O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1-(4-methylphenyl)-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2cccs2)C2=C(CCCC2=O)N/1c1ccc(C)cc1 |
| InChI | InChI=1S/C28H26N2O2S/c1-17-8-12-19(13-9-17)27(32)26-25(23-7-4-16-33-23)24-21(5-3-6-22(24)31)30(28(26)29)20-14-10-18(2)11-15-20/h4,7-16,25,29,32H,3,5-6H2,1-2H3/b27-26+,29-28- |
| InChIKey | IBYAYLLGCIXASO-TZZNUMCQSA-N |
| XLogP | 6.92 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|