C31H32N2O2S — CID 135815511
(3E)-1-(4-ethylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135815511) has the molecular formula C31H32N2O2S and a molecular weight of 496.68 g/mol. Its IUPAC name is (3E)-1-(4-ethylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E)-1-(4-ethylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135815511 |
| Molecular Formula | C31H32N2O2S |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (3E)-1-(4-ethylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2cccs2)C2=C(CC(C)(C)CC2=O)N/1c1ccc(CC)cc1 |
| InChI | InChI=1S/C31H32N2O2S/c1-5-20-10-14-22(15-11-20)33-23-17-31(3,4)18-24(34)26(23)27(25-7-6-16-36-25)28(30(33)32)29(35)21-12-8-19(2)9-13-21/h6-16,27,32,35H,5,17-18H2,1-4H3/b29-28+,32-30- |
| InChIKey | BAGZTQJPYRXOQQ-JUSAUZGOSA-N |
| XLogP | 7.81 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|