C29H28N2O2S — CID 135670875
(3E)-1-(4-ethylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135670875) has the molecular formula C29H28N2O2S and a molecular weight of 468.62 g/mol. Its IUPAC name is (3E)-1-(4-ethylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-1-(4-ethylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135670875 |
| Molecular Formula | C29H28N2O2S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (3E)-1-(4-ethylphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-thiophen-2-yl-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2cccs2)C2=C(CCCC2=O)N/1c1ccc(CC)cc1 |
| InChI | InChI=1S/C29H28N2O2S/c1-3-19-11-15-21(16-12-19)31-22-6-4-7-23(32)25(22)26(24-8-5-17-34-24)27(29(31)30)28(33)20-13-9-18(2)10-14-20/h5,8-17,26,30,33H,3-4,6-7H2,1-2H3/b28-27+,30-29- |
| InChIKey | PHYDXDDPEFXNGW-FUGFHMGBSA-N |
| XLogP | 7.18 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|