C29H26N2O2 — CID 135420247
(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1,4-diphenyl-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135420247) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is (3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1,4-diphenyl-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1,4-diphenyl-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135420247 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1,4-diphenyl-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2ccccc2)C2=C(CCCC2=O)N/1c1ccccc1 |
| InChI | InChI=1S/C29H26N2O2/c1-19-15-17-21(18-16-19)28(33)27-25(20-9-4-2-5-10-20)26-23(13-8-14-24(26)32)31(29(27)30)22-11-6-3-7-12-22/h2-7,9-12,15-18,25,30,33H,8,13-14H2,1H3/b28-27+,30-29- |
| InChIKey | SRJMWMHGBCAZRP-FUGFHMGBSA-N |
| XLogP | 6.55 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|