C28H23BrN2O2 — CID 135441445
(3E)-4-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-1-phenyl-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135441445) has the molecular formula C28H23BrN2O2 and a molecular weight of 499.41 g/mol. Its IUPAC name is (3E)-4-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-1-phenyl-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-4-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-1-phenyl-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135441445 |
| Molecular Formula | C28H23BrN2O2 |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | (3E)-4-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-1-phenyl-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccccc2)/C(c2ccc(Br)cc2)C2=C(CCCC2=O)N/1c1ccccc1 |
| InChI | InChI=1S/C28H23BrN2O2/c29-20-16-14-18(15-17-20)24-25-22(12-7-13-23(25)32)31(21-10-5-2-6-11-21)28(30)26(24)27(33)19-8-3-1-4-9-19/h1-6,8-11,14-17,24,30,33H,7,12-13H2/b27-26+,30-28- |
| InChIKey | OYJVOQQNGIUOBI-LXWBOPCWSA-N |
| XLogP | 7.01 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|