C29H25ClN2O2 — CID 135570063
(3E,4R)-1-(3-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-phenyl-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135570063) has the molecular formula C29H25ClN2O2 and a molecular weight of 468.98 g/mol. Its IUPAC name is (3E,4R)-1-(3-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-phenyl-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E,4R)-1-(3-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-phenyl-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135570063 |
| Molecular Formula | C29H25ClN2O2 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (3E,4R)-1-(3-chlorophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-phenyl-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/[C@@H](c2ccccc2)C2=C(CCCC2=O)N/1c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H25ClN2O2/c1-18-13-15-20(16-14-18)28(34)27-25(19-7-3-2-4-8-19)26-23(11-6-12-24(26)33)32(29(27)31)22-10-5-9-21(30)17-22/h2-5,7-10,13-17,25,31,34H,6,11-12H2,1H3/b28-27+,31-29-/t25-/m0/s1 |
| InChIKey | VEXRQVKEXBVURQ-GLBXYWRQSA-N |
| XLogP | 7.21 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|