C30H25Cl3N2O3 — CID 135815546
(3E)-1-(3-chloro-2-methylphenyl)-4-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135815546) has the molecular formula C30H25Cl3N2O3 and a molecular weight of 567.90 g/mol. Its IUPAC name is (3E)-1-(3-chloro-2-methylphenyl)-4-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-1-(3-chloro-2-methylphenyl)-4-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135815546 |
| Molecular Formula | C30H25Cl3N2O3 |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | (3E)-1-(3-chloro-2-methylphenyl)-4-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(OC)cc2)/C(c2ccc(Cl)cc2Cl)C2=C(CCCC2=O)N/1c1cccc(Cl)c1C |
| InChI | InChI=1S/C30H25Cl3N2O3/c1-16-21(32)5-3-6-23(16)35-24-7-4-8-25(36)27(24)26(20-14-11-18(31)15-22(20)33)28(30(35)34)29(37)17-9-12-19(38-2)13-10-17/h3,5-6,9-15,26,34,37H,4,7-8H2,1-2H3/b29-28+,34-30- |
| InChIKey | VTNPAXQEOYCETB-ANWIBCCMSA-N |
| XLogP | 8.52 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|