C30H27ClN2O4 — CID 136868614
(4R)-1-(4-chlorophenyl)-4-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 136868614) has the molecular formula C30H27ClN2O4 and a molecular weight of 515.01 g/mol. Its IUPAC name is (4R)-1-(4-chlorophenyl)-4-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (4R)-1-(4-chlorophenyl)-4-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 136868614 |
| Molecular Formula | C30H27ClN2O4 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | (4R)-1-(4-chlorophenyl)-4-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1/C(=C(O)c2ccccc2)[C@@H](c2cc(OC)ccc2OC)C2=C(CCCC2=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H27ClN2O4/c1-36-21-15-16-25(37-2)22(17-21)26-27-23(9-6-10-24(27)34)33(20-13-11-19(31)12-14-20)30(32)28(26)29(35)18-7-4-3-5-8-18/h3-5,7-8,11-17,26,32,35H,6,9-10H2,1-2H3/b29-28?,32-30-/t26-/m0/s1 |
| InChIKey | OAOSYTWGORSIFZ-IGRGXMCESA-N |
| XLogP | 6.91 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|