C31H26BrF3N2O2 — CID 135510893
4-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-1-[2-(trifluoromethyl)phenyl]-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135510893) has the molecular formula C31H26BrF3N2O2 and a molecular weight of 595.46 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-1-[2-(trifluoromethyl)phenyl]-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | 4-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-1-[2-(trifluoromethyl)phenyl]-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135510893 |
| Molecular Formula | C31H26BrF3N2O2 |
| Molecular Weight | 595.46 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | 4-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-1-[2-(trifluoromethyl)phenyl]-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1/C(=C(O)c2ccccc2)C(c2ccc(Br)cc2)C2=C(CC(C)(C)CC2=O)N1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C31H26BrF3N2O2/c1-30(2)16-23-26(24(38)17-30)25(18-12-14-20(32)15-13-18)27(28(39)19-8-4-3-5-9-19)29(36)37(23)22-11-7-6-10-21(22)31(33,34)35/h3-15,25,36,39H,16-17H2,1-2H3/b28-27?,36-29- |
| InChIKey | KILWLBGDVCTFHB-MKBWCDCFSA-N |
| XLogP | 8.66 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.46 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|