C30H32ClNO3 — CID 42645874
10-(2-chlorophenyl)-9-(4-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 42645874) has the molecular formula C30H32ClNO3 and a molecular weight of 490.04 g/mol. Its IUPAC name is 10-(2-chlorophenyl)-9-(4-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(2-chlorophenyl)-9-(4-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 42645874 |
| Molecular Formula | C30H32ClNO3 |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 10-(2-chlorophenyl)-9-(4-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | COc1ccc(C2C3=C(CC(C)(C)CC3=O)N(c3ccccc3Cl)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C30H32ClNO3/c1-29(2)14-22-27(24(33)16-29)26(18-10-12-19(35-5)13-11-18)28-23(15-30(3,4)17-25(28)34)32(22)21-9-7-6-8-20(21)31/h6-13,26H,14-17H2,1-5H3 |
| InChIKey | ABAOHXYGIZNENG-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |