C33H37NO6 — CID 5322481
methyl 4-[10-(2,4-dimethoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate (PubChem CID 5322481) has the molecular formula C33H37NO6 and a molecular weight of 543.66 g/mol. Its IUPAC name is methyl 4-[10-(2,4-dimethoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate.
| Compound Name | methyl 4-[10-(2,4-dimethoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate |
|---|---|
| PubChem CID | 5322481 |
| Molecular Formula | C33H37NO6 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | methyl 4-[10-(2,4-dimethoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C3=C(CC(C)(C)CC3=O)N(c3ccc(OC)cc3OC)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C33H37NO6/c1-32(2)15-23-29(25(35)17-32)28(19-8-10-20(11-9-19)31(37)40-7)30-24(16-33(3,4)18-26(30)36)34(23)22-13-12-21(38-5)14-27(22)39-6/h8-14,28H,15-18H2,1-7H3 |
| InChIKey | ZXUSGNATZMOEQY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |