C34H40N2O6 — CID 2968100
2-[2-methoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 2968100) has the molecular formula C34H40N2O6 and a molecular weight of 572.70 g/mol. Its IUPAC name is 2-[2-methoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2968100 |
| Molecular Formula | C34H40N2O6 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 2-[2-methoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(C3C4=C(CC(C)(C)CC4=O)N(C)C4=C3C(=O)CC(C)(C)C4)cc2OC)cc1 |
| InChI | InChI=1S/C34H40N2O6/c1-33(2)15-23-31(25(37)17-33)30(32-24(36(23)5)16-34(3,4)18-26(32)38)20-8-13-27(28(14-20)41-7)42-19-29(39)35-21-9-11-22(40-6)12-10-21/h8-14,30H,15-19H2,1-7H3,(H,35,39) |
| InChIKey | ZFTXUHOJKPJUDA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |