C37H46N2O5 — CID 126273682
N-(2,4-dimethylphenyl)-2-[2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide (PubChem CID 126273682) has the molecular formula C37H46N2O5 and a molecular weight of 598.78 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126273682 |
| Molecular Formula | C37H46N2O5 |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide |
| SMILES | CCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(OCC(=O)Nc3ccc(C)cc3C)c(OC)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C37H46N2O5/c1-9-14-39-26-17-36(4,5)19-28(40)34(26)33(35-27(39)18-37(6,7)20-29(35)41)24-11-13-30(31(16-24)43-8)44-21-32(42)38-25-12-10-22(2)15-23(25)3/h10-13,15-16,33H,9,14,17-21H2,1-8H3,(H,38,42) |
| InChIKey | NCBVXBORLMXSBR-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |