C35H41ClN2O4 — CID 126259519
2-[4-chloro-2-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126259519) has the molecular formula C35H41ClN2O4 and a molecular weight of 589.18 g/mol. Its IUPAC name is 2-[4-chloro-2-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126259519 |
| Molecular Formula | C35H41ClN2O4 |
| Molecular Weight | 589.18 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | 2-[4-chloro-2-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Cl)ccc2OCC(=O)Nc2ccc(C)cc2C)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C35H41ClN2O4/c1-8-38-25-15-34(4,5)17-27(39)32(25)31(33-26(38)16-35(6,7)18-28(33)40)23-14-22(36)10-12-29(23)42-19-30(41)37-24-11-9-20(2)13-21(24)3/h9-14,31H,8,15-19H2,1-7H3,(H,37,41) |
| InChIKey | AYOVTCGJZNZGJU-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.18 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |