C41H45ClN2O4 — CID 126273169
2-[2-chloro-4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126273169) has the molecular formula C41H45ClN2O4 and a molecular weight of 665.27 g/mol. Its IUPAC name is 2-[2-chloro-4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126273169 |
| Molecular Formula | C41H45ClN2O4 |
| Molecular Weight | 665.27 g/mol |
| Exact Mass | 664.31 |
| IUPAC Name | 2-[2-chloro-4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C3C4=C(CC(C)(C)CC4=O)N(CCc4ccccc4)C4=C3C(=O)CC(C)(C)C4)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C41H45ClN2O4/c1-25-12-14-30(26(2)18-25)43-36(47)24-48-35-15-13-28(19-29(35)42)37-38-31(20-40(3,4)22-33(38)45)44(17-16-27-10-8-7-9-11-27)32-21-41(5,6)23-34(46)39(32)37/h7-15,18-19,37H,16-17,20-24H2,1-6H3,(H,43,47) |
| InChIKey | ZVSJHOIJSWTQPR-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.27 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |