C36H44Cl2N2O5 — CID 46741709
2-[2-chloro-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-methylacetamide;1-chloro-2-methylbenzene (PubChem CID 46741709) has the molecular formula C36H44Cl2N2O5 and a molecular weight of 655.66 g/mol. Its IUPAC name is 2-[2-chloro-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-methylacetamide;1-chloro-2-methylbenzene.
| Compound Name | 2-[2-chloro-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-methylacetamide;1-chloro-2-methylbenzene |
|---|---|
| PubChem CID | 46741709 |
| Molecular Formula | C36H44Cl2N2O5 |
| Molecular Weight | 655.66 g/mol |
| Exact Mass | 654.26 |
| IUPAC Name | 2-[2-chloro-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-methylacetamide;1-chloro-2-methylbenzene |
| SMILES | CNC(=O)COc1ccc(C2C3=C(CC(C)(C)CC3=O)N(CCOC)C3=C2C(=O)CC(C)(C)C3)cc1Cl.Cc1ccccc1Cl |
| InChI | InChI=1S/C29H37ClN2O5.C7H7Cl/c1-28(2)12-19-26(21(33)14-28)25(17-7-8-23(18(30)11-17)37-16-24(35)31-5)27-20(32(19)9-10-36-6)13-29(3,4)15-22(27)34;1-6-4-2-3-5-7(6)8/h7-8,11,25H,9-10,12-16H2,1-6H3,(H,31,35);2-5H,1H3 |
| InChIKey | HLFLQGNMMDTQOJ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.66 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |