C28H34ClNO6 — CID 126070449
2-[2-chloro-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetic acid (PubChem CID 126070449) has the molecular formula C28H34ClNO6 and a molecular weight of 516.03 g/mol. Its IUPAC name is 2-[2-chloro-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126070449 |
| Molecular Formula | C28H34ClNO6 |
| Molecular Weight | 516.03 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 2-[2-chloro-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetic acid |
| SMILES | COCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(OCC(=O)O)c(Cl)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C28H34ClNO6/c1-27(2)11-18-25(20(31)13-27)24(16-6-7-22(17(29)10-16)36-15-23(33)34)26-19(30(18)8-9-35-5)12-28(3,4)14-21(26)32/h6-7,10,24H,8-9,11-15H2,1-5H3,(H,33,34) |
| InChIKey | BKKIYCYKSXPBLO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.03 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |