C29H35NO8 — CID 39366603
2-[9-[4-(carboxymethoxy)-3-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid (PubChem CID 39366603) has the molecular formula C29H35NO8 and a molecular weight of 525.60 g/mol. Its IUPAC name is 2-[9-[4-(carboxymethoxy)-3-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[4-(carboxymethoxy)-3-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 39366603 |
| Molecular Formula | C29H35NO8 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 2-[9-[4-(carboxymethoxy)-3-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(CC(=O)O)C3=C2C(=O)CC(C)(C)C3)ccc1OCC(=O)O |
| InChI | InChI=1S/C29H35NO8/c1-6-37-22-9-16(7-8-21(22)38-15-24(35)36)25-26-17(10-28(2,3)12-19(26)31)30(14-23(33)34)18-11-29(4,5)13-20(32)27(18)25/h7-9,25H,6,10-15H2,1-5H3,(H,33,34)(H,35,36) |
| InChIKey | CPXWPIUCRDZPSC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |