C30H39NO7 — CID 126078876
2-[2-methoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetic acid (PubChem CID 126078876) has the molecular formula C30H39NO7 and a molecular weight of 525.64 g/mol. Its IUPAC name is 2-[2-methoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126078876 |
| Molecular Formula | C30H39NO7 |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 2-[2-methoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetic acid |
| SMILES | COCCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(OCC(=O)O)c(OC)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C30H39NO7/c1-29(2)13-19-27(21(32)15-29)26(18-8-9-23(24(12-18)37-6)38-17-25(34)35)28-20(31(19)10-7-11-36-5)14-30(3,4)16-22(28)33/h8-9,12,26H,7,10-11,13-17H2,1-6H3,(H,34,35) |
| InChIKey | SGPCWASCFAKWHB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|