C29H34INO8 — CID 126071448
3-[9-[4-(carboxymethoxy)-3-iodo-5-methoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126071448) has the molecular formula C29H34INO8 and a molecular weight of 651.49 g/mol. Its IUPAC name is 3-[9-[4-(carboxymethoxy)-3-iodo-5-methoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[4-(carboxymethoxy)-3-iodo-5-methoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126071448 |
| Molecular Formula | C29H34INO8 |
| Molecular Weight | 651.49 g/mol |
| Exact Mass | 651.13 |
| IUPAC Name | 3-[9-[4-(carboxymethoxy)-3-iodo-5-methoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C29H34INO8/c1-28(2)10-17-25(19(32)12-28)24(15-8-16(30)27(21(9-15)38-5)39-14-23(36)37)26-18(31(17)7-6-22(34)35)11-29(3,4)13-20(26)33/h8-9,24H,6-7,10-14H2,1-5H3,(H,34,35)(H,36,37) |
| InChIKey | HCNPOLAMCMKPEX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|