C29H36ClNO6 — CID 126081216
3-[9-(3-chloro-4-ethoxy-5-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126081216) has the molecular formula C29H36ClNO6 and a molecular weight of 530.06 g/mol. Its IUPAC name is 3-[9-(3-chloro-4-ethoxy-5-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-(3-chloro-4-ethoxy-5-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126081216 |
| Molecular Formula | C29H36ClNO6 |
| Molecular Weight | 530.06 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 3-[9-(3-chloro-4-ethoxy-5-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CCOc1c(Cl)cc(C2C3=C(CC(C)(C)CC3=O)N(CCC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C29H36ClNO6/c1-7-37-27-17(30)10-16(11-22(27)36-6)24-25-18(12-28(2,3)14-20(25)32)31(9-8-23(34)35)19-13-29(4,5)15-21(33)26(19)24/h10-11,24H,7-9,12-15H2,1-6H3,(H,34,35) |
| InChIKey | NDJHIOGIFLFQCV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.06 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |