C34H36ClN3O10 — CID 126092615
3-[9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126092615) has the molecular formula C34H36ClN3O10 and a molecular weight of 682.13 g/mol. Its IUPAC name is 3-[9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126092615 |
| Molecular Formula | C34H36ClN3O10 |
| Molecular Weight | 682.13 g/mol |
| Exact Mass | 681.21 |
| IUPAC Name | 3-[9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc(Cl)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C34H36ClN3O10/c1-6-47-27-12-18(11-20(35)32(27)48-26-8-7-19(37(43)44)13-21(26)38(45)46)29-30-22(14-33(2,3)16-24(30)39)36(10-9-28(41)42)23-15-34(4,5)17-25(40)31(23)29/h7-8,11-13,29H,6,9-10,14-17H2,1-5H3,(H,41,42) |
| InChIKey | YVACXBGDAMLCNB-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 179.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.13 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|