C31H30ClN3O9 — CID 126087694
2-[9-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126087694) has the molecular formula C31H30ClN3O9 and a molecular weight of 624.05 g/mol. Its IUPAC name is 2-[9-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126087694 |
| Molecular Formula | C31H30ClN3O9 |
| Molecular Weight | 624.05 g/mol |
| Exact Mass | 623.17 |
| IUPAC Name | 2-[9-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CC(=O)O)C1=C(C(=O)CC(C)(C)C1)C2c1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C31H30ClN3O9/c1-30(2)11-20-28(22(36)13-30)27(29-21(33(20)15-26(38)39)12-31(3,4)14-23(29)37)16-5-7-24(18(32)9-16)44-25-8-6-17(34(40)41)10-19(25)35(42)43/h5-10,27H,11-15H2,1-4H3,(H,38,39) |
| InChIKey | PNTCAISKXJFEKM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.05 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|