C30H30BrN3O7 — CID 126096697
9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126096697) has the molecular formula C30H30BrN3O7 and a molecular weight of 624.49 g/mol. Its IUPAC name is 9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126096697 |
| Molecular Formula | C30H30BrN3O7 |
| Molecular Weight | 624.49 g/mol |
| Exact Mass | 623.13 |
| IUPAC Name | 9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Br)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C30H30BrN3O7/c1-29(2)12-20-27(22(35)14-29)26(28-21(32(20)5)13-30(3,4)15-23(28)36)16-6-8-24(18(31)10-16)41-25-9-7-17(33(37)38)11-19(25)34(39)40/h6-11,26H,12-15H2,1-5H3 |
| InChIKey | MJWCIEMQQJJRCM-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.49 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|