C32H34BrN3O7 — CID 126093826
9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-10-propyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126093826) has the molecular formula C32H34BrN3O7 and a molecular weight of 652.54 g/mol. Its IUPAC name is 9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-10-propyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-10-propyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126093826 |
| Molecular Formula | C32H34BrN3O7 |
| Molecular Weight | 652.54 g/mol |
| Exact Mass | 651.16 |
| IUPAC Name | 9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-10-propyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Br)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C32H34BrN3O7/c1-6-11-34-22-14-31(2,3)16-24(37)29(22)28(30-23(34)15-32(4,5)17-25(30)38)18-7-9-26(20(33)12-18)43-27-10-8-19(35(39)40)13-21(27)36(41)42/h7-10,12-13,28H,6,11,14-17H2,1-5H3 |
| InChIKey | CQFOEDTWEITXDR-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.54 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|