C31H32BrN3O7 — CID 126087584
9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126087584) has the molecular formula C31H32BrN3O7 and a molecular weight of 638.52 g/mol. Its IUPAC name is 9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126087584 |
| Molecular Formula | C31H32BrN3O7 |
| Molecular Weight | 638.52 g/mol |
| Exact Mass | 637.14 |
| IUPAC Name | 9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Br)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C31H32BrN3O7/c1-6-33-21-13-30(2,3)15-23(36)28(21)27(29-22(33)14-31(4,5)16-24(29)37)17-7-9-25(19(32)11-17)42-26-10-8-18(34(38)39)12-20(26)35(40)41/h7-12,27H,6,13-16H2,1-5H3 |
| InChIKey | GQYFJBZIGGSFPD-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.52 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|