C32H32ClF3N2O5 — CID 126091662
9-[3-chloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126091662) has the molecular formula C32H32ClF3N2O5 and a molecular weight of 617.06 g/mol. Its IUPAC name is 9-[3-chloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-chloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126091662 |
| Molecular Formula | C32H32ClF3N2O5 |
| Molecular Weight | 617.06 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 9-[3-chloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(Cl)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C32H32ClF3N2O5/c1-6-37-21-13-30(2,3)15-23(39)28(21)27(29-22(37)14-31(4,5)16-24(29)40)17-7-9-25(19(33)11-17)43-26-10-8-18(32(34,35)36)12-20(26)38(41)42/h7-12,27H,6,13-16H2,1-5H3 |
| InChIKey | SAFWUXXYGSYJKQ-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.06 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|