C34H36BrF3N2O7 — CID 126099445
9-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126099445) has the molecular formula C34H36BrF3N2O7 and a molecular weight of 721.57 g/mol. Its IUPAC name is 9-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126099445 |
| Molecular Formula | C34H36BrF3N2O7 |
| Molecular Weight | 721.57 g/mol |
| Exact Mass | 720.17 |
| IUPAC Name | 9-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | COCCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Br)c(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C34H36BrF3N2O7/c1-32(2)14-22-29(24(41)16-32)28(30-23(39(22)9-10-45-5)15-33(3,4)17-25(30)42)18-11-20(35)31(27(12-18)46-6)47-26-8-7-19(34(36,37)38)13-21(26)40(43)44/h7-8,11-13,28H,9-10,14-17H2,1-6H3 |
| InChIKey | XHAJKPJBSIZYMY-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.57 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|