C34H35Br2F3N2O6 — CID 126098514
9-[3,5-dibromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126098514) has the molecular formula C34H35Br2F3N2O6 and a molecular weight of 784.46 g/mol. Its IUPAC name is 9-[3,5-dibromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3,5-dibromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126098514 |
| Molecular Formula | C34H35Br2F3N2O6 |
| Molecular Weight | 784.46 g/mol |
| Exact Mass | 782.08 |
| IUPAC Name | 9-[3,5-dibromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | COCCCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Br)cc(Br)c2Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C34H35Br2F3N2O6/c1-32(2)14-23-29(25(42)16-32)28(30-24(40(23)9-6-10-46-5)15-33(3,4)17-26(30)43)20-12-19(35)13-21(36)31(20)47-27-8-7-18(34(37,38)39)11-22(27)41(44)45/h7-8,11-13,28H,6,9-10,14-17H2,1-5H3 |
| InChIKey | VUXRFTSBSYWPNE-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.46 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|