C27H33N2O6- — CID 2179342
4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-2-nitrophenolate (PubChem CID 2179342) has the molecular formula C27H33N2O6- and a molecular weight of 481.57 g/mol. Its IUPAC name is 4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-2-nitrophenolate.
| Compound Name | 4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-2-nitrophenolate |
|---|---|
| PubChem CID | 2179342 |
| Molecular Formula | C27H33N2O6- |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-2-nitrophenolate |
| SMILES | COCCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc([O-])c([N+](=O)[O-])c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C27H34N2O6/c1-26(2)12-18-24(21(31)14-26)23(16-7-8-20(30)17(11-16)29(33)34)25-19(28(18)9-6-10-35-5)13-27(3,4)15-22(25)32/h7-8,11,23,30H,6,9-10,12-15H2,1-5H3/p-1 |
| InChIKey | PCQLQWAJGXLKJC-UHFFFAOYSA-M |
| XLogP | 4.39 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|