C26H32BrNO4 — CID 4161359
9-(3-bromo-4-hydroxyphenyl)-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 4161359) has the molecular formula C26H32BrNO4 and a molecular weight of 502.45 g/mol. Its IUPAC name is 9-(3-bromo-4-hydroxyphenyl)-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3-bromo-4-hydroxyphenyl)-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 4161359 |
| Molecular Formula | C26H32BrNO4 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 9-(3-bromo-4-hydroxyphenyl)-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | COCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(O)c(Br)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C26H32BrNO4/c1-25(2)11-17-23(20(30)13-25)22(15-6-7-19(29)16(27)10-15)24-18(28(17)8-9-32-5)12-26(3,4)14-21(24)31/h6-7,10,22,29H,8-9,11-14H2,1-5H3 |
| InChIKey | QKPYAGUEVSUGGM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |