C27H32BrNO5 — CID 126077245
2-[2-bromo-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid (PubChem CID 126077245) has the molecular formula C27H32BrNO5 and a molecular weight of 530.46 g/mol. Its IUPAC name is 2-[2-bromo-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 126077245 |
| Molecular Formula | C27H32BrNO5 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 2-[2-bromo-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(OCC(=O)O)c(Br)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C27H32BrNO5/c1-6-29-17-10-26(2,3)12-19(30)24(17)23(25-18(29)11-27(4,5)13-20(25)31)15-7-8-21(16(28)9-15)34-14-22(32)33/h7-9,23H,6,10-14H2,1-5H3,(H,32,33) |
| InChIKey | HCXDAHRPNOJHPI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |