C27H32Br2N2O4 — CID 126233280
2-[2,6-dibromo-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide (PubChem CID 126233280) has the molecular formula C27H32Br2N2O4 and a molecular weight of 608.37 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide.
| Compound Name | 2-[2,6-dibromo-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126233280 |
| Molecular Formula | C27H32Br2N2O4 |
| Molecular Weight | 608.37 g/mol |
| Exact Mass | 606.07 |
| IUPAC Name | 2-[2,6-dibromo-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Br)c(OCC(N)=O)c(Br)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C27H32Br2N2O4/c1-6-31-17-9-26(2,3)11-19(32)23(17)22(24-18(31)10-27(4,5)12-20(24)33)14-7-15(28)25(16(29)8-14)35-13-21(30)34/h7-8,22H,6,9-13H2,1-5H3,(H2,30,34) |
| InChIKey | XIFBHDCGXPDDJW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |