C28H33Cl2NO5 — CID 126077921
2-[2,6-dichloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid (PubChem CID 126077921) has the molecular formula C28H33Cl2NO5 and a molecular weight of 534.48 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid.
| Compound Name | 2-[2,6-dichloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 126077921 |
| Molecular Formula | C28H33Cl2NO5 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 2-[2,6-dichloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetic acid |
| SMILES | CCCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Cl)c(OCC(=O)O)c(Cl)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C28H33Cl2NO5/c1-6-7-31-18-10-27(2,3)12-20(32)24(18)23(25-19(31)11-28(4,5)13-21(25)33)15-8-16(29)26(17(30)9-15)36-14-22(34)35/h8-9,23H,6-7,10-14H2,1-5H3,(H,34,35) |
| InChIKey | HBSHTOFXKBJTBF-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |