C37H45ClN2O5 — CID 126270180
2-[2-chloro-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126270180) has the molecular formula C37H45ClN2O5 and a molecular weight of 633.23 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126270180 |
| Molecular Formula | C37H45ClN2O5 |
| Molecular Weight | 633.23 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | CCCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Cl)c(OCC(=O)Nc3cccc(C)c3)c(OCC)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C37H45ClN2O5/c1-8-13-40-26-17-36(4,5)19-28(41)33(26)32(34-27(40)18-37(6,7)20-29(34)42)23-15-25(38)35(30(16-23)44-9-2)45-21-31(43)39-24-12-10-11-22(3)14-24/h10-12,14-16,32H,8-9,13,17-21H2,1-7H3,(H,39,43) |
| InChIKey | JCKMGRPILXUROQ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.23 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |