C42H47ClN2O5 — CID 126274664
2-[2-chloro-6-ethoxy-4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126274664) has the molecular formula C42H47ClN2O5 and a molecular weight of 695.30 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126274664 |
| Molecular Formula | C42H47ClN2O5 |
| Molecular Weight | 695.30 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCc3ccccc3)C3=C2C(=O)CC(C)(C)C3)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C42H47ClN2O5/c1-7-49-35-20-28(19-30(43)40(35)50-25-36(48)44-29-15-13-26(2)14-16-29)37-38-31(21-41(3,4)23-33(38)46)45(18-17-27-11-9-8-10-12-27)32-22-42(5,6)24-34(47)39(32)37/h8-16,19-20,37H,7,17-18,21-25H2,1-6H3,(H,44,48) |
| InChIKey | UPYFUSXRHPJEJR-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.30 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |