C38H37Cl3N2O4 — CID 126267921
2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 126267921) has the molecular formula C38H37Cl3N2O4 and a molecular weight of 692.08 g/mol. Its IUPAC name is 2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126267921 |
| Molecular Formula | C38H37Cl3N2O4 |
| Molecular Weight | 692.08 g/mol |
| Exact Mass | 690.18 |
| IUPAC Name | 2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(Cc1ccccc1)C1=C(C(=O)CC(C)(C)C1)C2c1cc(Cl)c(OCC(=O)Nc2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C38H37Cl3N2O4/c1-37(2)16-28-34(30(44)18-37)33(35-29(17-38(3,4)19-31(35)45)43(28)20-22-8-6-5-7-9-22)23-14-26(40)36(27(41)15-23)47-21-32(46)42-25-12-10-24(39)11-13-25/h5-15,33H,16-21H2,1-4H3,(H,42,46) |
| InChIKey | AWAZLHUYRXFXAP-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.08 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |