C31H31Cl2NO5 — CID 126274832
2-[2,6-dichloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide (PubChem CID 126274832) has the molecular formula C31H31Cl2NO5 and a molecular weight of 568.50 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2,6-dichloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126274832 |
| Molecular Formula | C31H31Cl2NO5 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 2-[2,6-dichloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2c1cc(Cl)c(OCC(=O)Nc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C31H31Cl2NO5/c1-30(2)12-21(35)27-23(14-30)39-24-15-31(3,4)13-22(36)28(24)26(27)17-10-19(32)29(20(33)11-17)38-16-25(37)34-18-8-6-5-7-9-18/h5-11,26H,12-16H2,1-4H3,(H,34,37) |
| InChIKey | XHELYIXVKUKZBE-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |