C33H35ClFNO6 — CID 126367482
2-[2-chloro-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 126367482) has the molecular formula C33H35ClFNO6 and a molecular weight of 596.10 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126367482 |
| Molecular Formula | C33H35ClFNO6 |
| Molecular Weight | 596.10 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc(Cl)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C33H35ClFNO6/c1-6-40-24-12-18(11-21(34)31(24)41-17-27(39)36-20-9-7-19(35)8-10-20)28-29-22(37)13-32(2,3)15-25(29)42-26-16-33(4,5)14-23(38)30(26)28/h7-12,28H,6,13-17H2,1-5H3,(H,36,39) |
| InChIKey | INXLFPXAQZFTQQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.10 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |