C32H33FINO6 — CID 126367415
N-(4-fluorophenyl)-2-[2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide (PubChem CID 126367415) has the molecular formula C32H33FINO6 and a molecular weight of 673.52 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126367415 |
| Molecular Formula | C32H33FINO6 |
| Molecular Weight | 673.52 g/mol |
| Exact Mass | 673.13 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc(I)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C32H33FINO6/c1-31(2)12-21(36)28-24(14-31)41-25-15-32(3,4)13-22(37)29(25)27(28)17-10-20(34)30(23(11-17)39-5)40-16-26(38)35-19-8-6-18(33)7-9-19/h6-11,27H,12-16H2,1-5H3,(H,35,38) |
| InChIKey | HOFRCDNWNRHRGQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.52 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|