C32H34ClIN2O5 — CID 126230156
N-(4-chlorophenyl)-2-[2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide (PubChem CID 126230156) has the molecular formula C32H34ClIN2O5 and a molecular weight of 688.99 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126230156 |
| Molecular Formula | C32H34ClIN2O5 |
| Molecular Weight | 688.99 g/mol |
| Exact Mass | 688.12 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-iodo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetamide |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc(I)c1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H34ClIN2O5/c1-31(2)12-21-28(23(37)14-31)27(29-22(36-21)13-32(3,4)15-24(29)38)17-10-20(34)30(25(11-17)40-5)41-16-26(39)35-19-8-6-18(33)7-9-19/h6-11,27,36H,12-16H2,1-5H3,(H,35,39) |
| InChIKey | HWWZIIKDKNMHBN-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.99 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|