C34H39ClN2O5 — CID 126266980
2-[2-chloro-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 126266980) has the molecular formula C34H39ClN2O5 and a molecular weight of 591.15 g/mol. Its IUPAC name is 2-[2-chloro-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-chloro-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126266980 |
| Molecular Formula | C34H39ClN2O5 |
| Molecular Weight | 591.15 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 2-[2-chloro-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc(Cl)c1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C34H39ClN2O5/c1-18-8-9-21(10-19(18)2)36-28(40)17-42-32-22(35)11-20(12-27(32)41-7)29-30-23(13-33(3,4)15-25(30)38)37-24-14-34(5,6)16-26(39)31(24)29/h8-12,29,37H,13-17H2,1-7H3,(H,36,40) |
| InChIKey | WVVNYKGVFJYJNI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.15 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |